C26H24N4O6S2 — CID 43909462
2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide (PubChem CID 43909462) has the molecular formula C26H24N4O6S2 and a molecular weight of 552.63 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43909462 |
| Molecular Formula | C26H24N4O6S2 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
| SMILES | COc1cccc(N(CC(=O)Nc2ccc(S(=O)(=O)Nc3cccnc3)cc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N4O6S2/c1-36-23-9-5-8-22(17-23)30(38(34,35)25-10-3-2-4-11-25)19-26(31)28-20-12-14-24(15-13-20)37(32,33)29-21-7-6-16-27-18-21/h2-18,29H,19H2,1H3,(H,28,31) |
| InChIKey | MNPLYDOCFUFSBE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |