C21H29FN4O3S — CID 43909013
N-[4-(diethylaminomethyl)phenyl]-2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetamide (PubChem CID 43909013) has the molecular formula C21H29FN4O3S and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[4-(diethylaminomethyl)phenyl]-2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetamide.
| Compound Name | N-[4-(diethylaminomethyl)phenyl]-2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetamide |
|---|---|
| PubChem CID | 43909013 |
| Molecular Formula | C21H29FN4O3S |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-[4-(diethylaminomethyl)phenyl]-2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetamide |
| SMILES | CCN(CC)Cc1ccc(NC(=O)CN(c2ccccc2F)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H29FN4O3S/c1-5-25(6-2)15-17-11-13-18(14-12-17)23-21(27)16-26(30(28,29)24(3)4)20-10-8-7-9-19(20)22/h7-14H,5-6,15-16H2,1-4H3,(H,23,27) |
| InChIKey | KXLDQAVTDBOGHK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |