C19H21ClFN3O5S — CID 92677264
ethyl 2-chloro-5-[[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]amino]benzoate (PubChem CID 92677264) has the molecular formula C19H21ClFN3O5S and a molecular weight of 457.91 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 92677264 |
| Molecular Formula | C19H21ClFN3O5S |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN(c2ccccc2F)S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C19H21ClFN3O5S/c1-4-29-19(26)14-11-13(9-10-15(14)20)22-18(25)12-24(30(27,28)23(2)3)17-8-6-5-7-16(17)21/h5-11H,4,12H2,1-3H3,(H,22,25) |
| InChIKey | LFLPTSGHSGQOKL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |