C24H22ClFN2O6S — CID 30275557
ethyl 2-chloro-4-[[2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzoate (PubChem CID 30275557) has the molecular formula C24H22ClFN2O6S and a molecular weight of 520.97 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30275557 |
| Molecular Formula | C24H22ClFN2O6S |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | ethyl 2-chloro-4-[[2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(c2ccccc2F)S(=O)(=O)c2ccc(OC)cc2)cc1Cl |
| InChI | InChI=1S/C24H22ClFN2O6S/c1-3-34-24(30)19-13-8-16(14-20(19)25)27-23(29)15-28(22-7-5-4-6-21(22)26)35(31,32)18-11-9-17(33-2)10-12-18/h4-14H,3,15H2,1-2H3,(H,27,29) |
| InChIKey | DTNWYUCCODXKGH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |