C21H18F2N2O4S — CID 30266194
2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(3-fluorophenyl)acetamide (PubChem CID 30266194) has the molecular formula C21H18F2N2O4S and a molecular weight of 432.45 g/mol. Its IUPAC name is 2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 30266194 |
| Molecular Formula | C21H18F2N2O4S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(3-fluorophenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2cccc(F)c2)c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H18F2N2O4S/c1-29-17-9-11-18(12-10-17)30(27,28)25(20-8-3-2-7-19(20)23)14-21(26)24-16-6-4-5-15(22)13-16/h2-13H,14H2,1H3,(H,24,26) |
| InChIKey | KDQFKULNGVGPIV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |