C24H25FN2O6S — CID 30272598
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-(3-ethoxyphenyl)acetamide (PubChem CID 30272598) has the molecular formula C24H25FN2O6S and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-(3-ethoxyphenyl)acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-(3-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 30272598 |
| Molecular Formula | C24H25FN2O6S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-(3-ethoxyphenyl)acetamide |
| SMILES | CCOc1cccc(NC(=O)CN(c2ccccc2F)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C24H25FN2O6S/c1-4-33-18-9-7-8-17(14-18)26-24(28)16-27(21-11-6-5-10-20(21)25)34(29,30)19-12-13-22(31-2)23(15-19)32-3/h5-15H,4,16H2,1-3H3,(H,26,28) |
| InChIKey | ZKIRKTUMHWOUAV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |