C27H31FN2O6S — CID 30301649
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide (PubChem CID 30301649) has the molecular formula C27H31FN2O6S and a molecular weight of 530.62 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30301649 |
| Molecular Formula | C27H31FN2O6S |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide |
| SMILES | CCOc1ccc(CCCNC(=O)CN(c2ccccc2F)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H31FN2O6S/c1-4-36-21-13-11-20(12-14-21)8-7-17-29-27(31)19-30(24-10-6-5-9-23(24)28)37(32,33)22-15-16-25(34-2)26(18-22)35-3/h5-6,9-16,18H,4,7-8,17,19H2,1-3H3,(H,29,31) |
| InChIKey | NQGQWGZIKIKLTC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|