C24H32FN3O5S — CID 30272123
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-(3-piperidin-1-ylpropyl)acetamide (PubChem CID 30272123) has the molecular formula C24H32FN3O5S and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-(3-piperidin-1-ylpropyl)acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-(3-piperidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 30272123 |
| Molecular Formula | C24H32FN3O5S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-(3-piperidin-1-ylpropyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCN2CCCCC2)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C24H32FN3O5S/c1-32-22-12-11-19(17-23(22)33-2)34(30,31)28(21-10-5-4-9-20(21)25)18-24(29)26-13-8-16-27-14-6-3-7-15-27/h4-5,9-12,17H,3,6-8,13-16,18H2,1-2H3,(H,26,29) |
| InChIKey | NYTBBXGLIDYZAR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|