C29H27FN2O5S — CID 43900869
N-benzhydryl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide (PubChem CID 43900869) has the molecular formula C29H27FN2O5S and a molecular weight of 534.61 g/mol. Its IUPAC name is N-benzhydryl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide.
| Compound Name | N-benzhydryl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 43900869 |
| Molecular Formula | C29H27FN2O5S |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | N-benzhydryl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NC(c2ccccc2)c2ccccc2)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C29H27FN2O5S/c1-36-26-18-17-23(19-27(26)37-2)38(34,35)32(25-16-10-9-15-24(25)30)20-28(33)31-29(21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-19,29H,20H2,1-2H3,(H,31,33) |
| InChIKey | GZHBEKRCGWMQKM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |