C27H31FN2O5S — CID 43901290
N-(2-benzylbutyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide (PubChem CID 43901290) has the molecular formula C27H31FN2O5S and a molecular weight of 514.62 g/mol. Its IUPAC name is N-(2-benzylbutyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide.
| Compound Name | N-(2-benzylbutyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 43901290 |
| Molecular Formula | C27H31FN2O5S |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | N-(2-benzylbutyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide |
| SMILES | CCC(CNC(=O)CN(c1ccccc1F)S(=O)(=O)c1ccc(OC)c(OC)c1)Cc1ccccc1 |
| InChI | InChI=1S/C27H31FN2O5S/c1-4-20(16-21-10-6-5-7-11-21)18-29-27(31)19-30(24-13-9-8-12-23(24)28)36(32,33)22-14-15-25(34-2)26(17-22)35-3/h5-15,17,20H,4,16,18-19H2,1-3H3,(H,29,31) |
| InChIKey | CGXJLYVJJSUBID-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |