C30H29FN2O5S — CID 43899402
N,N-dibenzyl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide (PubChem CID 43899402) has the molecular formula C30H29FN2O5S and a molecular weight of 548.64 g/mol. Its IUPAC name is N,N-dibenzyl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide.
| Compound Name | N,N-dibenzyl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 43899402 |
| Molecular Formula | C30H29FN2O5S |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | N,N-dibenzyl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N(Cc2ccccc2)Cc2ccccc2)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C30H29FN2O5S/c1-37-28-18-17-25(19-29(28)38-2)39(35,36)33(27-16-10-9-15-26(27)31)22-30(34)32(20-23-11-5-3-6-12-23)21-24-13-7-4-8-14-24/h3-19H,20-22H2,1-2H3 |
| InChIKey | RVMKZLIDVCSGKB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |