C23H23FN2O5S — CID 30256831
N-benzyl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide (PubChem CID 30256831) has the molecular formula C23H23FN2O5S and a molecular weight of 458.51 g/mol. Its IUPAC name is N-benzyl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide.
| Compound Name | N-benzyl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 30256831 |
| Molecular Formula | C23H23FN2O5S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-benzyl-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCc2ccccc2)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C23H23FN2O5S/c1-30-21-13-12-18(14-22(21)31-2)32(28,29)26(20-11-7-6-10-19(20)24)16-23(27)25-15-17-8-4-3-5-9-17/h3-14H,15-16H2,1-2H3,(H,25,27) |
| InChIKey | KZKPBLUBFZLEAJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |