C25H34FN3O5S — CID 30273469
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-[3-(4-methylpiperidin-1-yl)propyl]acetamide (PubChem CID 30273469) has the molecular formula C25H34FN3O5S and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-[3-(4-methylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-[3-(4-methylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 30273469 |
| Molecular Formula | C25H34FN3O5S |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)-N-[3-(4-methylpiperidin-1-yl)propyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCN2CCC(C)CC2)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C25H34FN3O5S/c1-19-11-15-28(16-12-19)14-6-13-27-25(30)18-29(22-8-5-4-7-21(22)26)35(31,32)20-9-10-23(33-2)24(17-20)34-3/h4-5,7-10,17,19H,6,11-16,18H2,1-3H3,(H,27,30) |
| InChIKey | AYIWWXNCBWFNHW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|