C28H33ClN2O7S — CID 43896535
2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide (PubChem CID 43896535) has the molecular formula C28H33ClN2O7S and a molecular weight of 577.10 g/mol. Its IUPAC name is 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide.
| Compound Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 43896535 |
| Molecular Formula | C28H33ClN2O7S |
| Molecular Weight | 577.10 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide |
| SMILES | CCOc1ccc(CCCNC(=O)CN(c2cc(Cl)ccc2OC)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H33ClN2O7S/c1-5-38-22-11-8-20(9-12-22)7-6-16-30-28(32)19-31(24-17-21(29)10-14-25(24)35-2)39(33,34)23-13-15-26(36-3)27(18-23)37-4/h8-15,17-18H,5-7,16,19H2,1-4H3,(H,30,32) |
| InChIKey | BXTRTUJRVUOMQA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.10 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|