C25H25ClFN3O6S — CID 43898010
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide (PubChem CID 43898010) has the molecular formula C25H25ClFN3O6S and a molecular weight of 550.01 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 43898010 |
| Molecular Formula | C25H25ClFN3O6S |
| Molecular Weight | 550.01 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NCCCc1ccc(F)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H25ClFN3O6S/c1-17-5-11-21(15-22(17)30(32)33)37(34,35)29(23-14-19(26)8-12-24(23)36-2)16-25(31)28-13-3-4-18-6-9-20(27)10-7-18/h5-12,14-15H,3-4,13,16H2,1-2H3,(H,28,31) |
| InChIKey | CESIKJBBDTZZPH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.01 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|