C23H20Cl3N3O6S — CID 51345505
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[(2,4-dichlorophenyl)methyl]acetamide (PubChem CID 51345505) has the molecular formula C23H20Cl3N3O6S and a molecular weight of 572.85 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[(2,4-dichlorophenyl)methyl]acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[(2,4-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 51345505 |
| Molecular Formula | C23H20Cl3N3O6S |
| Molecular Weight | 572.85 g/mol |
| Exact Mass | 571.01 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[(2,4-dichlorophenyl)methyl]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NCc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20Cl3N3O6S/c1-14-3-7-18(11-20(14)29(31)32)36(33,34)28(21-10-17(25)6-8-22(21)35-2)13-23(30)27-12-15-4-5-16(24)9-19(15)26/h3-11H,12-13H2,1-2H3,(H,27,30) |
| InChIKey | KNUUYIWEXXNMFX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|