C27H26ClN5O6S — CID 43886437
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[[2-(2-methylimidazol-1-yl)phenyl]methyl]acetamide (PubChem CID 43886437) has the molecular formula C27H26ClN5O6S and a molecular weight of 584.05 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[[2-(2-methylimidazol-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[[2-(2-methylimidazol-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 43886437 |
| Molecular Formula | C27H26ClN5O6S |
| Molecular Weight | 584.05 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[[2-(2-methylimidazol-1-yl)phenyl]methyl]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NCc1ccccc1-n1ccnc1C)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H26ClN5O6S/c1-18-8-10-22(15-24(18)33(35)36)40(37,38)32(25-14-21(28)9-11-26(25)39-3)17-27(34)30-16-20-6-4-5-7-23(20)31-13-12-29-19(31)2/h4-15H,16-17H2,1-3H3,(H,30,34) |
| InChIKey | ZXWGGJVURKHPHT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.05 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|