C22H19Cl2N3O6S — CID 51345480
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(3-chlorophenyl)acetamide (PubChem CID 51345480) has the molecular formula C22H19Cl2N3O6S and a molecular weight of 524.38 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 51345480 |
| Molecular Formula | C22H19Cl2N3O6S |
| Molecular Weight | 524.38 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(3-chlorophenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)Nc1cccc(Cl)c1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H19Cl2N3O6S/c1-14-6-8-18(12-19(14)27(29)30)34(31,32)26(20-11-16(24)7-9-21(20)33-2)13-22(28)25-17-5-3-4-15(23)10-17/h3-12H,13H2,1-2H3,(H,25,28) |
| InChIKey | PEMIBXJJYLEPQB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|