C28H23Cl2N3O7S — CID 126276520
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(5-chloro-2-phenoxyphenyl)acetamide (PubChem CID 126276520) has the molecular formula C28H23Cl2N3O7S and a molecular weight of 616.48 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(5-chloro-2-phenoxyphenyl)acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(5-chloro-2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126276520 |
| Molecular Formula | C28H23Cl2N3O7S |
| Molecular Weight | 616.48 g/mol |
| Exact Mass | 615.06 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(5-chloro-2-phenoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)Nc1cc(Cl)ccc1Oc1ccccc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H23Cl2N3O7S/c1-18-8-11-22(16-24(18)33(35)36)41(37,38)32(25-15-20(30)10-13-27(25)39-2)17-28(34)31-23-14-19(29)9-12-26(23)40-21-6-4-3-5-7-21/h3-16H,17H2,1-2H3,(H,31,34) |
| InChIKey | DPNPMTGAAGNYAB-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|