C28H25ClN2O6S — CID 126278871
N-(5-chloro-2-phenoxyphenyl)-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide (PubChem CID 126278871) has the molecular formula C28H25ClN2O6S and a molecular weight of 553.04 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126278871 |
| Molecular Formula | C28H25ClN2O6S |
| Molecular Weight | 553.04 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2cc(Cl)ccc2Oc2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C28H25ClN2O6S/c1-35-26-16-14-23(18-27(26)36-2)38(33,34)31(21-9-5-3-6-10-21)19-28(32)30-24-17-20(29)13-15-25(24)37-22-11-7-4-8-12-22/h3-18H,19H2,1-2H3,(H,30,32) |
| InChIKey | RSYIEAXWFTYPIA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.04 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |