C29H27ClN2O6S — CID 126390068
2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-(5-chloro-2-phenoxyphenyl)acetamide (PubChem CID 126390068) has the molecular formula C29H27ClN2O6S and a molecular weight of 567.06 g/mol. Its IUPAC name is 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-(5-chloro-2-phenoxyphenyl)acetamide.
| Compound Name | 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-(5-chloro-2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126390068 |
| Molecular Formula | C29H27ClN2O6S |
| Molecular Weight | 567.06 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-(5-chloro-2-phenoxyphenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2cc(Cl)ccc2Oc2ccccc2)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C29H27ClN2O6S/c1-36-27-16-14-24(18-28(27)37-2)39(34,35)32(19-21-9-5-3-6-10-21)20-29(33)31-25-17-22(30)13-15-26(25)38-23-11-7-4-8-12-23/h3-18H,19-20H2,1-2H3,(H,31,33) |
| InChIKey | ABKNDMZMKDDVCX-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.06 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |