C23H23BrN2O5S — CID 1362081
2-[benzyl-(4-bromophenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 1362081) has the molecular formula C23H23BrN2O5S and a molecular weight of 519.42 g/mol. Its IUPAC name is 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1362081 |
| Molecular Formula | C23H23BrN2O5S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CN(Cc2ccccc2)S(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C23H23BrN2O5S/c1-30-19-10-13-22(31-2)21(14-19)25-23(27)16-26(15-17-6-4-3-5-7-17)32(28,29)20-11-8-18(24)9-12-20/h3-14H,15-16H2,1-2H3,(H,25,27) |
| InChIKey | YAEBPILTWJKARA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |