C23H21Br2N3O4S — CID 98091448
2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide (PubChem CID 98091448) has the molecular formula C23H21Br2N3O4S and a molecular weight of 595.31 g/mol. Its IUPAC name is 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 98091448 |
| Molecular Formula | C23H21Br2N3O4S |
| Molecular Weight | 595.31 g/mol |
| Exact Mass | 592.96 |
| IUPAC Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(Br)cc1/C=N\NC(=O)CN(Cc1ccccc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H21Br2N3O4S/c1-32-22-12-9-20(25)13-18(22)14-26-27-23(29)16-28(15-17-5-3-2-4-6-17)33(30,31)21-10-7-19(24)8-11-21/h2-14H,15-16H2,1H3,(H,27,29)/b26-14- |
| InChIKey | FAPVYKRTXDAUIO-WGARJPEWSA-N |
| XLogP | 4.56 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|