C21H20BrN3O5S — CID 94847274
2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide (PubChem CID 94847274) has the molecular formula C21H20BrN3O5S and a molecular weight of 506.38 g/mol. Its IUPAC name is 2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 94847274 |
| Molecular Formula | C21H20BrN3O5S |
| Molecular Weight | 506.38 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | 2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(Br)cc1/C=N\NC(=O)CN(Cc1ccco1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20BrN3O5S/c1-29-20-10-9-17(22)12-16(20)13-23-24-21(26)15-25(14-18-6-5-11-30-18)31(27,28)19-7-3-2-4-8-19/h2-13H,14-15H2,1H3,(H,24,26)/b23-13- |
| InChIKey | XAFSFAFYDNEPTH-QRVIBDJDSA-N |
| XLogP | 3.39 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|