C20H18BrN3O5S — CID 137157567
2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 137157567) has the molecular formula C20H18BrN3O5S and a molecular weight of 492.35 g/mol. Its IUPAC name is 2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137157567 |
| Molecular Formula | C20H18BrN3O5S |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | 2-[benzenesulfonyl(furan-2-ylmethyl)amino]-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(Cc1ccco1)S(=O)(=O)c1ccccc1)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C20H18BrN3O5S/c21-16-8-9-19(25)15(11-16)12-22-23-20(26)14-24(13-17-5-4-10-29-17)30(27,28)18-6-2-1-3-7-18/h1-12,25H,13-14H2,(H,23,26)/b22-12- |
| InChIKey | NFNHCYSDVNSSLZ-UUYOSTAYSA-N |
| XLogP | 3.09 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|