C22H17Br2Cl2N3O4S — CID 137168117
N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]acetamide (PubChem CID 137168117) has the molecular formula C22H17Br2Cl2N3O4S and a molecular weight of 650.18 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]acetamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 137168117 |
| Molecular Formula | C22H17Br2Cl2N3O4S |
| Molecular Weight | 650.18 g/mol |
| Exact Mass | 646.87 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(Br)cc1)N/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C22H17Br2Cl2N3O4S/c23-16-2-6-19(7-3-16)34(32,33)29(12-14-1-5-18(25)10-20(14)26)13-22(31)28-27-11-15-9-17(24)4-8-21(15)30/h1-11,30H,12-13H2,(H,28,31)/b27-11+ |
| InChIKey | GDPSDPOFKLHEIS-LUOAPIJWSA-N |
| XLogP | 5.57 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.18 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|