C15H14BrCl2N3O3S — CID 126371825
4-bromo-N-[(2,4-dichlorophenyl)methyl]-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide (PubChem CID 126371825) has the molecular formula C15H14BrCl2N3O3S and a molecular weight of 467.17 g/mol. Its IUPAC name is 4-bromo-N-[(2,4-dichlorophenyl)methyl]-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-[(2,4-dichlorophenyl)methyl]-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 126371825 |
| Molecular Formula | C15H14BrCl2N3O3S |
| Molecular Weight | 467.17 g/mol |
| Exact Mass | 464.93 |
| IUPAC Name | 4-bromo-N-[(2,4-dichlorophenyl)methyl]-N-(2-hydrazinyl-2-oxoethyl)benzenesulfonamide |
| SMILES | NNC(=O)CN(Cc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrCl2N3O3S/c16-11-2-5-13(6-3-11)25(23,24)21(9-15(22)20-19)8-10-1-4-12(17)7-14(10)18/h1-7H,8-9,19H2,(H,20,22) |
| InChIKey | ILSLKVZROMYWAB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|