C21H14BrCl5N2O3S — CID 21372976
2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 21372976) has the molecular formula C21H14BrCl5N2O3S and a molecular weight of 631.59 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 21372976 |
| Molecular Formula | C21H14BrCl5N2O3S |
| Molecular Weight | 631.59 g/mol |
| Exact Mass | 627.84 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(Br)cc1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H14BrCl5N2O3S/c22-13-2-5-15(6-3-13)33(31,32)29(10-12-1-4-14(23)7-16(12)24)11-21(30)28-20-9-18(26)17(25)8-19(20)27/h1-9H,10-11H2,(H,28,30) |
| InChIKey | LPECEINPQCEREQ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.59 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|