C22H16BrCl4N3O3S — CID 126378249
2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(E)-(3,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 126378249) has the molecular formula C22H16BrCl4N3O3S and a molecular weight of 624.17 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(E)-(3,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(E)-(3,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126378249 |
| Molecular Formula | C22H16BrCl4N3O3S |
| Molecular Weight | 624.17 g/mol |
| Exact Mass | 620.88 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(E)-(3,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(Br)cc1)N/N=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H16BrCl4N3O3S/c23-16-3-6-18(7-4-16)34(32,33)30(12-15-2-5-17(24)10-20(15)26)13-22(31)29-28-11-14-1-8-19(25)21(27)9-14/h1-11H,12-13H2,(H,29,31)/b28-11+ |
| InChIKey | YEXYINQZWMXTKM-IPBVOBEMSA-N |
| XLogP | 6.40 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.17 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|