C22H18BrCl2N3O3S — CID 98105346
2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 98105346) has the molecular formula C22H18BrCl2N3O3S and a molecular weight of 555.28 g/mol. Its IUPAC name is 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 98105346 |
| Molecular Formula | C22H18BrCl2N3O3S |
| Molecular Weight | 555.28 g/mol |
| Exact Mass | 552.96 |
| IUPAC Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccc(Br)cc1)N/N=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18BrCl2N3O3S/c23-18-7-9-19(10-8-18)32(30,31)28(14-16-4-2-1-3-5-16)15-22(29)27-26-13-17-6-11-20(24)21(25)12-17/h1-13H,14-15H2,(H,27,29)/b26-13- |
| InChIKey | CLUJNQJVNXXIAV-ZMFRSBBQSA-N |
| XLogP | 5.10 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|