C24H24BrClN4O3S — CID 126149973
2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]acetamide (PubChem CID 126149973) has the molecular formula C24H24BrClN4O3S and a molecular weight of 563.91 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126149973 |
| Molecular Formula | C24H24BrClN4O3S |
| Molecular Weight | 563.91 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]acetamide |
| SMILES | CN(C)c1ccc(/C=N\NC(=O)CN(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H24BrClN4O3S/c1-29(2)22-11-5-18(6-12-22)15-27-28-24(31)17-30(16-19-3-9-21(26)10-4-19)34(32,33)23-13-7-20(25)8-14-23/h3-15H,16-17H2,1-2H3,(H,28,31)/b27-15- |
| InChIKey | HZPALAMSDCJDIN-DICXZTSXSA-N |
| XLogP | 4.51 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|