C22H18Br2ClN3O4S — CID 137168159
N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]acetamide (PubChem CID 137168159) has the molecular formula C22H18Br2ClN3O4S and a molecular weight of 615.73 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 137168159 |
| Molecular Formula | C22H18Br2ClN3O4S |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 612.91 |
| IUPAC Name | N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1)S(=O)(=O)c1ccc(Br)cc1)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C22H18Br2ClN3O4S/c23-17-3-8-20(9-4-17)33(31,32)28(13-15-1-6-19(25)7-2-15)14-22(30)27-26-12-16-11-18(24)5-10-21(16)29/h1-12,29H,13-14H2,(H,27,30)/b26-12- |
| InChIKey | OUTBEHZOBIYRJD-ZRGSRPPYSA-N |
| XLogP | 4.91 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|