C22H19Cl2N3O4S — CID 135644179
2-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135644179) has the molecular formula C22H19Cl2N3O4S and a molecular weight of 492.38 g/mol. Its IUPAC name is 2-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135644179 |
| Molecular Formula | C22H19Cl2N3O4S |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 2-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C22H19Cl2N3O4S/c23-19-11-10-16(12-20(19)24)14-27(32(30,31)18-7-2-1-3-8-18)15-22(29)26-25-13-17-6-4-5-9-21(17)28/h1-13,28H,14-15H2,(H,26,29)/b25-13+ |
| InChIKey | SZBZASCIRJNLED-DHRITJCHSA-N |
| XLogP | 4.04 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|