C24H22Cl2N4O4S — CID 3682983
2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(2,3-dichlorophenyl)methylideneamino]acetamide (PubChem CID 3682983) has the molecular formula C24H22Cl2N4O4S and a molecular weight of 533.44 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(2,3-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(2,3-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3682983 |
| Molecular Formula | C24H22Cl2N4O4S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(2,3-dichlorophenyl)methylideneamino]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CC(=O)NN=Cc2cccc(Cl)c2Cl)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22Cl2N4O4S/c1-17(31)28-20-10-12-21(13-11-20)35(33,34)30(15-18-6-3-2-4-7-18)16-23(32)29-27-14-19-8-5-9-22(25)24(19)26/h2-14H,15-16H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | JVPGXCCDYJMQCG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|