C23H21Cl2N3O4S — CID 94846825
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide (PubChem CID 94846825) has the molecular formula C23H21Cl2N3O4S and a molecular weight of 506.41 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 94846825 |
| Molecular Formula | C23H21Cl2N3O4S |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2c(Cl)cccc2Cl)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21Cl2N3O4S/c1-32-18-10-12-19(13-11-18)33(30,31)28(15-17-6-3-2-4-7-17)16-23(29)27-26-14-20-21(24)8-5-9-22(20)25/h2-14H,15-16H2,1H3,(H,27,29)/b26-14- |
| InChIKey | MJPHSVPHCKCEIA-WGARJPEWSA-N |
| XLogP | 4.34 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|