C30H29N3O5S — CID 6033568
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 6033568) has the molecular formula C30H29N3O5S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6033568 |
| Molecular Formula | C30H29N3O5S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccccc2OCc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H29N3O5S/c1-37-27-16-18-28(19-17-27)39(35,36)33(21-24-10-4-2-5-11-24)22-30(34)32-31-20-26-14-8-9-15-29(26)38-23-25-12-6-3-7-13-25/h2-20H,21-23H2,1H3,(H,32,34)/b31-20- |
| InChIKey | UXNPJSRGNUMGSP-GTWSWNCMSA-N |
| XLogP | 4.62 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|