C29H24Cl3N3O4S — CID 126064432
2-[(4-chlorophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 126064432) has the molecular formula C29H24Cl3N3O4S and a molecular weight of 616.95 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126064432 |
| Molecular Formula | C29H24Cl3N3O4S |
| Molecular Weight | 616.95 g/mol |
| Exact Mass | 615.06 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(Cl)cc1)N/N=C\c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H24Cl3N3O4S/c30-24-12-14-26(15-13-24)40(37,38)35(18-23-10-11-25(31)16-27(23)32)19-29(36)34-33-17-22-8-4-5-9-28(22)39-20-21-6-2-1-3-7-21/h1-17H,18-20H2,(H,34,36)/b33-17- |
| InChIKey | RVSJEXKUYUGAQF-FZPRHHONSA-N |
| XLogP | 6.57 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.95 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|