C23H20Cl2FN3O3S — CID 126066405
2-[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide (PubChem CID 126066405) has the molecular formula C23H20Cl2FN3O3S and a molecular weight of 508.40 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126066405 |
| Molecular Formula | C23H20Cl2FN3O3S |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccccc2F)Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2FN3O3S/c1-16-6-10-20(11-7-16)33(31,32)29(14-18-8-9-19(24)12-21(18)25)15-23(30)28-27-13-17-4-2-3-5-22(17)26/h2-13H,14-15H2,1H3,(H,28,30)/b27-13- |
| InChIKey | UNINGCRBJMOSMD-WKIKZPBSSA-N |
| XLogP | 4.78 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|