C23H20Cl2N4O5S — CID 126068059
2-[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide (PubChem CID 126068059) has the molecular formula C23H20Cl2N4O5S and a molecular weight of 535.41 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126068059 |
| Molecular Formula | C23H20Cl2N4O5S |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2cccc([N+](=O)[O-])c2)Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2N4O5S/c1-16-5-9-21(10-6-16)35(33,34)28(14-18-7-8-19(24)12-22(18)25)15-23(30)27-26-13-17-3-2-4-20(11-17)29(31)32/h2-13H,14-15H2,1H3,(H,27,30)/b26-13- |
| InChIKey | ZPTBAVPNCWWUAH-ZMFRSBBQSA-N |
| XLogP | 4.55 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|