C24H22Cl3N3O5S — CID 126064095
2-[(4-chlorophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 126064095) has the molecular formula C24H22Cl3N3O5S and a molecular weight of 570.88 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126064095 |
| Molecular Formula | C24H22Cl3N3O5S |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(/C=N\NC(=O)CN(Cc2ccc(Cl)cc2Cl)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H22Cl3N3O5S/c1-34-20-7-10-23(35-2)17(11-20)13-28-29-24(31)15-30(14-16-3-4-19(26)12-22(16)27)36(32,33)21-8-5-18(25)6-9-21/h3-13H,14-15H2,1-2H3,(H,29,31)/b28-13- |
| InChIKey | LVGOJTVTDUVCFH-QDTIIGTASA-N |
| XLogP | 5.01 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|