C24H23BrN4O4S — CID 6086929
2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(Z)-(3-bromophenyl)methylideneamino]acetamide (PubChem CID 6086929) has the molecular formula C24H23BrN4O4S and a molecular weight of 543.44 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(Z)-(3-bromophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(Z)-(3-bromophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6086929 |
| Molecular Formula | C24H23BrN4O4S |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(Z)-(3-bromophenyl)methylideneamino]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2cccc(Br)c2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23BrN4O4S/c1-18(30)27-22-10-12-23(13-11-22)34(32,33)29(16-19-6-3-2-4-7-19)17-24(31)28-26-15-20-8-5-9-21(25)14-20/h2-15H,16-17H2,1H3,(H,27,30)(H,28,31)/b26-15- |
| InChIKey | FELDRWCGNOEAQN-YSMPRRRNSA-N |
| XLogP | 3.75 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|