C30H30BrN5O4S — CID 99653384
2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 99653384) has the molecular formula C30H30BrN5O4S and a molecular weight of 636.57 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 99653384 |
| Molecular Formula | C30H30BrN5O4S |
| Molecular Weight | 636.57 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CC(=O)N/N=C/c2cc(C)n(-c3cccc(Br)c3)c2C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H30BrN5O4S/c1-21-16-25(22(2)36(21)28-11-7-10-26(31)17-28)18-32-34-30(38)20-35(19-24-8-5-4-6-9-24)41(39,40)29-14-12-27(13-15-29)33-23(3)37/h4-18H,19-20H2,1-3H3,(H,33,37)(H,34,38)/b32-18+ |
| InChIKey | QVJKXYAZYRMUPQ-KCSSXMTESA-N |
| XLogP | 5.16 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|