C31H32ClN5O4S — CID 98051926
2-[(4-acetamidophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 98051926) has the molecular formula C31H32ClN5O4S and a molecular weight of 606.15 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98051926 |
| Molecular Formula | C31H32ClN5O4S |
| Molecular Weight | 606.15 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CCc2ccccc2)CC(=O)N/N=C/c2cc(C)n(-c3ccc(Cl)cc3)c2C)cc1 |
| InChI | InChI=1S/C31H32ClN5O4S/c1-22-19-26(23(2)37(22)29-13-9-27(32)10-14-29)20-33-35-31(39)21-36(18-17-25-7-5-4-6-8-25)42(40,41)30-15-11-28(12-16-30)34-24(3)38/h4-16,19-20H,17-18,21H2,1-3H3,(H,34,38)(H,35,39)/b33-20+ |
| InChIKey | AGAUDZBCUFAPRF-FMFFXOCNSA-N |
| XLogP | 5.09 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.15 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|