C24H26ClN5O4S — CID 45374226
2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 45374226) has the molecular formula C24H26ClN5O4S and a molecular weight of 516.02 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 45374226 |
| Molecular Formula | C24H26ClN5O4S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)N/N=C\c2cc(C)n(-c3ccc(Cl)cc3)c2C)cc1 |
| InChI | InChI=1S/C24H26ClN5O4S/c1-16-13-19(17(2)30(16)22-9-5-20(25)6-10-22)14-26-28-24(32)15-29(4)35(33,34)23-11-7-21(8-12-23)27-18(3)31/h5-14H,15H2,1-4H3,(H,27,31)(H,28,32)/b26-14- |
| InChIKey | NXWQPORQJBFERD-WGARJPEWSA-N |
| XLogP | 3.48 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|