C19H22ClN3O3S — CID 9174623
2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]acetamide (PubChem CID 9174623) has the molecular formula C19H22ClN3O3S and a molecular weight of 407.92 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9174623 |
| Molecular Formula | C19H22ClN3O3S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)c(/C=N\NC(=O)CN(C)S(=O)(=O)c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C19H22ClN3O3S/c1-13-9-14(2)18(15(3)10-13)11-21-22-19(24)12-23(4)27(25,26)17-7-5-16(20)6-8-17/h5-11H,12H2,1-4H3,(H,22,24)/b21-11- |
| InChIKey | QAIFGLBADFRUHJ-NHDPSOOVSA-N |
| XLogP | 3.04 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|