C31H33N5O5S — CID 98099964
2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(E)-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 98099964) has the molecular formula C31H33N5O5S and a molecular weight of 587.70 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(E)-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(E)-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98099964 |
| Molecular Formula | C31H33N5O5S |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-benzylamino]-N-[(E)-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(-n2c(C)cc(/C=N/NC(=O)CN(Cc3ccccc3)S(=O)(=O)c3ccc(NC(C)=O)cc3)c2C)cc1 |
| InChI | InChI=1S/C31H33N5O5S/c1-22-18-26(23(2)36(22)28-12-14-29(41-4)15-13-28)19-32-34-31(38)21-35(20-25-8-6-5-7-9-25)42(39,40)30-16-10-27(11-17-30)33-24(3)37/h5-19H,20-21H2,1-4H3,(H,33,37)(H,34,38)/b32-19+ |
| InChIKey | AFOREPFYUYZHFF-BIZUNTBRSA-N |
| XLogP | 4.40 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|