C32H36N4O6S — CID 98082994
2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[(E)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 98082994) has the molecular formula C32H36N4O6S and a molecular weight of 604.73 g/mol. Its IUPAC name is 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[(E)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[(E)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98082994 |
| Molecular Formula | C32H36N4O6S |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[(E)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(C)cc(/C=N/NC(=O)CN(Cc3ccccc3)S(=O)(=O)c3ccc(OC)c(OC)c3)c2C)cc1 |
| InChI | InChI=1S/C32H36N4O6S/c1-6-42-28-14-12-27(13-15-28)36-23(2)18-26(24(36)3)20-33-34-32(37)22-35(21-25-10-8-7-9-11-25)43(38,39)29-16-17-30(40-4)31(19-29)41-5/h7-20H,6,21-22H2,1-5H3,(H,34,37)/b33-20+ |
| InChIKey | VSTYLZRBTMMYOB-FMFFXOCNSA-N |
| XLogP | 4.85 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|