C31H32Cl2N4O6S — CID 126033616
N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide (PubChem CID 126033616) has the molecular formula C31H32Cl2N4O6S and a molecular weight of 659.59 g/mol. Its IUPAC name is N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide.
| Compound Name | N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126033616 |
| Molecular Formula | C31H32Cl2N4O6S |
| Molecular Weight | 659.59 g/mol |
| Exact Mass | 658.14 |
| IUPAC Name | N-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N/N=C\c2cc(C)n(-c3ccc(Cl)cc3Cl)c2C)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C31H32Cl2N4O6S/c1-6-43-25-10-8-24(9-11-25)36(44(39,40)26-12-14-29(41-4)30(17-26)42-5)19-31(38)35-34-18-22-15-20(2)37(21(22)3)28-13-7-23(32)16-27(28)33/h7-18H,6,19H2,1-5H3,(H,35,38)/b34-18- |
| InChIKey | ASBRYDAVRBRFBT-HQDYHJHZSA-N |
| XLogP | 6.16 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|