C32H35ClN4O6S — CID 99677149
2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 99677149) has the molecular formula C32H35ClN4O6S and a molecular weight of 639.17 g/mol. Its IUPAC name is 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 99677149 |
| Molecular Formula | C32H35ClN4O6S |
| Molecular Weight | 639.17 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2cc(C)n(-c3ccc(C)c(C)c3)c2C)c2cc(Cl)ccc2OC)cc1OC |
| InChI | InChI=1S/C32H35ClN4O6S/c1-20-8-10-26(14-21(20)2)37-22(3)15-24(23(37)4)18-34-35-32(38)19-36(28-16-25(33)9-12-29(28)41-5)44(39,40)27-11-13-30(42-6)31(17-27)43-7/h8-18H,19H2,1-7H3,(H,35,38)/b34-18- |
| InChIKey | AVAAFKCWWVCALQ-HQDYHJHZSA-N |
| XLogP | 5.74 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.17 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|