C25H29ClN4O4S — CID 126189697
2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-[(Z)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 126189697) has the molecular formula C25H29ClN4O4S and a molecular weight of 517.05 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-[(Z)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-[(Z)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126189697 |
| Molecular Formula | C25H29ClN4O4S |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-[(Z)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)N/N=C\c1cc(C)n(-c2c(C)cccc2C)c1C)S(C)(=O)=O |
| InChI | InChI=1S/C25H29ClN4O4S/c1-16-8-7-9-17(2)25(16)30-18(3)12-20(19(30)4)14-27-28-24(31)15-29(35(6,32)33)22-13-21(26)10-11-23(22)34-5/h7-14H,15H2,1-6H3,(H,28,31)/b27-14- |
| InChIKey | COIYMNBBXZTXJF-VYYCAZPPSA-N |
| XLogP | 4.29 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|